ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4-Methoxyphenethyl alcohol |
|
produktnavn | 4-Methoxyphenethyl alcohol |
Engelsk navn | 4-Methoxyphenethyl alcohol;p-Methoxyphenethyl alcohol;2-(4-Methoxyphenyl)ethanol;p-Methoxyphenylethanol |
Molekylær Formel | C9H12O2 |
Molekylvekt | 152.1904 |
InChI | InChI=1/C9H12O2/c1-11-9-4-2-8(3-5-9)6-7-10/h2-5,10H,6-7H2,1H3 |
CAS-nummer | 702-23-8 |
EINECS | 211-866-6 |
Molecular Structure | |
Tetthet | 1.058g/cm3 |
Smeltepunkt | 28℃ |
Kokepunkt | 257.5°C at 760 mmHg |
Brytningsindeks | 1.524 |
Flammepunktet | 110.2°C |
Damptrykk | 0.00745mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |