ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
701-70-2 Alpha-Ethylphenethyl alcohol |
|
produktnavn | Alpha-Ethylphenethyl alcohol |
Engelsk navn | Alpha-Ethylphenethyl alcohol;1-Phenyl-2-butanol;1-phenylbutan-2-ol;(2S)-1-phenylbutan-2-ol;(2R)-1-phenylbutan-2-ol |
Molekylær Formel | C10H14O |
Molekylvekt | 150.2176 |
InChI | InChI=1/C10H14O/c1-2-10(11)8-9-6-4-3-5-7-9/h3-7,10-11H,2,8H2,1H3/t10-/m1/s1 |
CAS-nummer | 701-70-2 |
EINECS | 211-858-2 |
Molecular Structure | |
Tetthet | 0.98g/cm3 |
Kokepunkt | 226.6°C at 760 mmHg |
Brytningsindeks | 1.52 |
Flammepunktet | 100°C |
Damptrykk | 0.0459mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |