ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
700-35-6 2-chloro-4-fluoroacetophenone |
|
produktnavn | 2-chloro-4-fluoroacetophenone |
Engelsk navn | 2-chloro-4-fluoroacetophenone;2'-chloro-4'-fluoroacetophenone;1-(2-chloro-4-fluoro-phenyl)ethanone |
Molekylær Formel | C8H6ClFO |
Molekylvekt | 172.584 |
InChI | InChI=1/C8H6ClFO/c1-5(11)7-3-2-6(10)4-8(7)9/h2-4H,1H3 |
CAS-nummer | 700-35-6 |
Molecular Structure | |
Tetthet | 1.259g/cm3 |
Kokepunkt | 203.4°C at 760 mmHg |
Brytningsindeks | 1.512 |
Flammepunktet | 76.814°C |
Damptrykk | 0.278mmHg at 25°C |
Risiko Koder | R22##Harmful if swallowed.||R36/38##Irritating to eyes and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |