ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
5-Methylnicotinamide |
|
produktnavn | 5-Methylnicotinamide |
Engelsk navn | 5-Methylnicotinamide;5-Methylpyridine-3-carboxamide |
Molekylær Formel | C7H8N2O |
Molekylvekt | 136.1512 |
InChI | InChI=1/C7H8N2O/c1-5-2-6(7(8)10)4-9-3-5/h2-4H,1H3,(H2,8,10) |
CAS-nummer | 70-57-5 |
Molecular Structure | |
Tetthet | 1.157g/cm3 |
Kokepunkt | 290°C at 760 mmHg |
Brytningsindeks | 1.561 |
Flammepunktet | 129.2°C |
Damptrykk | 0.00213mmHg at 25°C |
Sikkerhet Beskrivelse | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |