ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
69-96-5 DL-threo-3-Phenylserine hydrate |
|
produktnavn | DL-threo-3-Phenylserine hydrate |
Engelsk navn | DL-threo-3-Phenylserine hydrate;3-Phenylserine monohydrate;DL-?-Phenylserine threoform DL-Threo-?-phenylserine;β-hydroxyphenylalanine hydrate (1:1);Dl-Beta-Phenylserine Threo Form |
Molekylær Formel | C9H13NO4 |
Molekylvekt | 199.2038 |
InChI | InChI=1/C9H11NO3.H2O/c10-7(9(12)13)8(11)6-4-2-1-3-5-6;/h1-5,7-8,11H,10H2,(H,12,13);1H2 |
CAS-nummer | 69-96-5 |
EINECS | 200-721-2 |
Molecular Structure | |
Smeltepunkt | 186℃ |
Kokepunkt | 483.1°C at 760 mmHg |
Flammepunktet | 246°C |
Damptrykk | 3.8E-10mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |