ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
68817-65-2 4',4pi(5pi)-Diacetyldibenzo-18-krone-6 |
|
produktnavn | 4',4pi(5pi)-Diacetyldibenzo-18-krone-6 |
Synonymer | ; 4,4(5)-Diacetyldibenzo-18-krone-6; 1,1'-(6,7,9,10,17,18,20,21-oktahydrodibenzo[b,k][1,4,7,10,13,16]heksaoksasyklooktadecin-2,13-diyl)dietanon; |
Engelsk navn | 4',4pi(5pi)-Diacetyldibenzo-18-crown-6;4,4(5)-Diacetyldibenzo-18-crown-6;1,1'-(6,7,9,10,17,18,20,21-octahydrodibenzo[b,k][1,4,7,10,13,16]hexaoxacyclooctadecine-2,13-diyl)diethanone |
Molekylær Formel | C24H28O8 |
Molekylvekt | 444.4743 |
InChI | InChI=1/C24H28O8/c1-17(25)19-3-5-21-23(15-19)31-13-9-27-8-12-30-22-6-4-20(18(2)26)16-24(22)32-14-10-28-7-11-29-21/h3-6,15-16H,7-14H2,1-2H3 |
CAS-nummer | 68817-65-2 |
Molecular Structure | |
Tetthet | 1.144g/cm3 |
Smeltepunkt | 194℃ |
Kokepunkt | 641.7°C at 760 mmHg |
Brytningsindeks | 1.508 |
Flammepunktet | 275.9°C |
Damptrykk | 2.31E-16mmHg at 25°C |
Hazard symboler | Xn##Harmful:; |
Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |