ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
65858-51-7 5-(bromomethyl)-6-chloro-2,1,3-benzothiadiazole |
|
produktnavn | 5-(bromomethyl)-6-chloro-2,1,3-benzothiadiazole |
Engelsk navn | 5-(bromomethyl)-6-chloro-2,1,3-benzothiadiazole; |
Molekylær Formel | C7H4BrClN2S |
Molekylvekt | 263.5421 |
InChI | InChI=1/C7H4BrClN2S/c8-3-4-1-6-7(2-5(4)9)11-12-10-6/h1-2H,3H2 |
CAS-nummer | 65858-51-7 |
Molecular Structure | ![]() |
Tetthet | 1.87g/cm3 |
Smeltepunkt | 75℃ |
Kokepunkt | 331.2°C at 760 mmHg |
Brytningsindeks | 1.729 |
Flammepunktet | 154.1°C |
Damptrykk | 0.000304mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R34##Causes burns.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |