ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
65858-50-6 5-(bromomethyl)-2,1,3-benzothiadiazole |
|
produktnavn | 5-(bromomethyl)-2,1,3-benzothiadiazole |
Engelsk navn | 5-(bromomethyl)-2,1,3-benzothiadiazole; |
Molekylær Formel | C7H5BrN2S |
Molekylvekt | 229.097 |
InChI | InChI=1/C7H5BrN2S/c8-4-5-1-2-6-7(3-5)10-11-9-6/h1-3H,4H2 |
CAS-nummer | 65858-50-6 |
Molecular Structure | ![]() |
Tetthet | 1.776g/cm3 |
Smeltepunkt | 87℃ |
Kokepunkt | 299.3°C at 760 mmHg |
Brytningsindeks | 1.726 |
Flammepunktet | 134.8°C |
Damptrykk | 0.00214mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R34##Causes burns.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |