ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
620-79-1 Ethyl 2-benzylacetoacetate |
|
produktnavn | Ethyl 2-benzylacetoacetate |
Engelsk navn | Ethyl 2-benzylacetoacetate;2-Benzylacetoacetic acid ethyl ester;ethyl 2-benzyl-3-oxobutanoate;ethyl (2S)-2-benzyl-3-oxobutanoate;ethyl (2R)-2-benzyl-3-oxobutanoate;Ethyl-2-benzylacetoacetate;Ethyl 2-acetyl-3-phenylpropionate |
Molekylær Formel | C13H16O3 |
Molekylvekt | 220.2643 |
InChI | InChI=1/C13H16O3/c1-3-16-13(15)12(10(2)14)9-11-7-5-4-6-8-11/h4-8,12H,3,9H2,1-2H3/t12-/m1/s1 |
CAS-nummer | 620-79-1 |
EINECS | 210-651-4 |
Molecular Structure | |
Tetthet | 1.07g/cm3 |
Kokepunkt | 276°C at 760 mmHg |
Brytningsindeks | 1.502 |
Flammepunktet | 132.3°C |
Damptrykk | 0.00493mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |