ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
618-76-8 4-hydroxy-3,5-diiodobenzoic acid |
|
produktnavn | 4-hydroxy-3,5-diiodobenzoic acid |
Engelsk navn | 4-hydroxy-3,5-diiodobenzoic acid;3,5-Diiodo-4-hydroxybenzoic acid |
Molekylær Formel | C7H4I2O3 |
Molekylvekt | 389.9138 |
InChI | InChI=1/C7H4I2O3/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,10H,(H,11,12) |
CAS-nummer | 618-76-8 |
EINECS | 210-562-0 |
Molecular Structure | |
Tetthet | 2.697g/cm3 |
Kokepunkt | 346.4°C at 760 mmHg |
Brytningsindeks | 1.784 |
Flammepunktet | 163.3°C |
Damptrykk | 2.19E-05mmHg at 25°C |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |