ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
618-32-6 Benzoyl bromide |
|
produktnavn | Benzoyl bromide |
Engelsk navn | Benzoyl bromide; |
Molekylær Formel | C7H5BrO |
Molekylvekt | 185.018 |
InChI | InChI=1/C7H5BrO/c8-7(9)6-4-2-1-3-5-6/h1-5H |
CAS-nummer | 618-32-6 |
EINECS | 210-544-2 |
Molecular Structure | |
Tetthet | 1.572g/cm3 |
Smeltepunkt | -24℃ |
Kokepunkt | 218.5°C at 760 mmHg |
Brytningsindeks | 1.584 |
Flammepunktet | 89.7°C |
Damptrykk | 0.125mmHg at 25°C |
Hazard symboler | C##Corrosive:; |
Risiko Koder | R34##Causes burns.:; |
Sikkerhet Beskrivelse | S25##Avoid contact with eyes.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |