ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Ethyl oxamate |
|
produktnavn | Ethyl oxamate |
Engelsk navn | Ethyl oxamate;oxamethane;Oxamic acid ethyl ester;ethyl amino(oxo)acetate |
Molekylær Formel | C4H7NO3 |
Molekylvekt | 117.1033 |
InChI | InChI=1/C4H7NO3/c1-2-8-4(7)3(5)6/h2H2,1H3,(H2,5,6) |
CAS-nummer | 617-36-7 |
EINECS | 210-512-8 |
Molecular Structure | |
Tetthet | 1.184g/cm3 |
Smeltepunkt | 112-115℃ |
Kokepunkt | 188.7°C at 760 mmHg |
Brytningsindeks | 1.437 |
Flammepunktet | 87°C |
Damptrykk | 0.59mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |