ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
617-05-0 Vanilicacidethylester; 97% |
|
produktnavn | Vanilicacidethylester; 97% |
Engelsk navn | Vanilicacidethylester; 97%;Vanilic acid ethyl ester;Ethyl vanillate;Ethyl 4-hydroxy-3-methoxybenzoate~Vanillic acid ethyl ester;4-Hydroxy-3-methoxybenzoic acid ethyl ester;ethyl 4-hydroxy-3-methoxybenzoate |
Molekylær Formel | C10H12O4 |
Molekylvekt | 196.1999 |
InChI | InChI=1/C10H12O4/c1-3-14-10(12)7-4-5-8(11)9(6-7)13-2/h4-6,11H,3H2,1-2H3 |
CAS-nummer | 617-05-0 |
EINECS | 210-503-9 |
Molecular Structure | ![]() |
Tetthet | 1.18g/cm3 |
Smeltepunkt | 39-41℃ |
Kokepunkt | 292°C at 760 mmHg |
Brytningsindeks | 1.528 |
Flammepunktet | 122.4°C |
Damptrykk | 0.00108mmHg at 25°C |
Sikkerhet Beskrivelse | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |