ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
617-02-7 o-Tolyl benzoate |
|
produktnavn | o-Tolyl benzoate |
Engelsk navn | o-Tolyl benzoate;o-Tolyl benzoate (Benzoic acid o-tolyl ester);Benzoic acid o-tolyl ester;2-methylphenyl benzoate |
Molekylær Formel | C14H12O2 |
Molekylvekt | 212.2439 |
InChI | InChI=1/C14H12O2/c1-11-7-5-6-10-13(11)16-14(15)12-8-3-2-4-9-12/h2-10H,1H3 |
CAS-nummer | 617-02-7 |
EINECS | 210-501-8 |
Molecular Structure | |
Tetthet | 1.122g/cm3 |
Kokepunkt | 368.9°C at 760 mmHg |
Brytningsindeks | 1.577 |
Flammepunktet | 154.5°C |
Damptrykk | 1.23E-05mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |