ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
616-21-7 1,2-Dichlorobutane |
|
produktnavn | 1,2-Dichlorobutane |
Engelsk navn | 1,2-Dichlorobutane;Butane, 1,2-dichloro-;HSDB 5717;NSC 93880 |
Molekylær Formel | C4H8Cl2 |
Molekylvekt | 127.0123 |
InChI | InChI=1/C4H8Cl2/c1-2-4(6)3-5/h4H,2-3H2,1H3 |
CAS-nummer | 616-21-7 |
EINECS | 210-469-5 |
Molecular Structure | |
Tetthet | 1.079g/cm3 |
Kokepunkt | 122.8°C at 760 mmHg |
Brytningsindeks | 1.427 |
Flammepunktet | 27.4°C |
Damptrykk | 16.5mmHg at 25°C |
Risiko Koder | R10##Flammable.:; |
Sikkerhet Beskrivelse | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |