Chemindex > 615-74-7
NO ▼
2-Chloro-5-methylphenol |
|
| produktnavn | 2-Chloro-5-methylphenol |
| Engelsk navn | 2-Chloro-5-methylphenol;4-Chloro-3-hydroxytoluene; 6-chloro-m-cresol |
| Molekylær Formel | C7H7ClO |
| Molekylvekt | 142.58 |
| InChI | InChI=1/C7H7ClO/c1-5-2-3-6(8)7(9)4-5/h2-4,9H,1H3 |
| CAS-nummer | 615-74-7 |
| EINECS | 210-444-9 |
| Molecular Structure |  |
| Tetthet | 1.215 |
| Smeltepunkt | 45-48℃ |
| Kokepunkt | 196℃ |
| Flammepunktet | 81℃ |
| Hazard symboler |  Xn##Harmful:; |
| Risiko Koder | R21/22##Harmful in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 615-74-7 (0):
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 