ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
614-83-5 2-Bromo-4-methylacetanilide |
|
produktnavn | 2-Bromo-4-methylacetanilide |
Engelsk navn | 2-Bromo-4-methylacetanilide;2-Bromo-4-methylactanilide;N-(2-bromo-4-methylphenyl)acetamide |
Molekylær Formel | C9H10BrNO |
Molekylvekt | 228.0858 |
InChI | InChI=1/C9H10BrNO/c1-6-3-4-9(8(10)5-6)11-7(2)12/h3-5H,1-2H3,(H,11,12) |
CAS-nummer | 614-83-5 |
Molecular Structure | |
Tetthet | 1.471g/cm3 |
Smeltepunkt | 117-119℃ |
Kokepunkt | 349.9°C at 760 mmHg |
Brytningsindeks | 1.6 |
Flammepunktet | 165.4°C |
Damptrykk | 4.57E-05mmHg at 25°C |
Sikkerhet Beskrivelse | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |