ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2'-Bromoacetanilide |
|
produktnavn | 2'-Bromoacetanilide |
Engelsk navn | 2'-Bromoacetanilide;2-Bromoacetanilide;N-(2-bromophenyl)acetamide |
Molekylær Formel | C8H8BrNO |
Molekylvekt | 214.0592 |
InChI | InChI=1/C8H8BrNO/c1-6(11)10-8-5-3-2-4-7(8)9/h2-5H,1H3,(H,10,11) |
CAS-nummer | 614-76-6 |
Molecular Structure | |
Tetthet | 1.543g/cm3 |
Smeltepunkt | 96.5-100.5℃ |
Kokepunkt | 346.8°C at 760 mmHg |
Brytningsindeks | 1.611 |
Flammepunktet | 163.5°C |
Damptrykk | 5.62E-05mmHg at 25°C |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |