ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
614-57-3 Cinnamylideneacetophenone |
|
produktnavn | Cinnamylideneacetophenone |
Engelsk navn | Cinnamylideneacetophenone;5-phenylpenta-2,4-dienophenone;1,5-Diphenyl-2,4-pentadien-1-one~5-Phenyl-2,4-pentadienophenone;1,5-diphenylpenta-2,4-dien-1-one;(2E,4E)-1,5-diphenylpenta-2,4-dien-1-one |
Molekylær Formel | C17H14O |
Molekylvekt | 234.2925 |
InChI | InChI=1/C17H14O/c18-17(16-12-5-2-6-13-16)14-8-7-11-15-9-3-1-4-10-15/h1-14H/b11-7+,14-8+ |
CAS-nummer | 614-57-3 |
EINECS | 210-385-9 |
Molecular Structure | |
Tetthet | 1.082g/cm3 |
Smeltepunkt | 100-102℃ |
Kokepunkt | 388.1°C at 760 mmHg |
Brytningsindeks | 1.624 |
Flammepunktet | 169.6°C |
Damptrykk | 3.15E-06mmHg at 25°C |
Sikkerhet Beskrivelse | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |