ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
614-10-8 4-(2-Methylphenyl)-3-thiosemicarbazide |
|
produktnavn | 4-(2-Methylphenyl)-3-thiosemicarbazide |
Engelsk navn | 4-(2-Methylphenyl)-3-thiosemicarbazide;4-(o-Tolyl)-3-thiosemicarbazide;N-(2-methylphenyl)hydrazinecarbothioamide;2-(2-methylphenyl)hydrazinecarbothioamide |
Molekylær Formel | C8H11N3S |
Molekylvekt | 181.258 |
InChI | InChI=1/C8H11N3S/c1-6-4-2-3-5-7(6)10-11-8(9)12/h2-5,10H,1H3,(H3,9,11,12) |
CAS-nummer | 614-10-8 |
Molecular Structure | |
Tetthet | 1.27g/cm3 |
Kokepunkt | 295.9°C at 760 mmHg |
Brytningsindeks | 1.699 |
Flammepunktet | 132.8°C |
Damptrykk | 0.00148mmHg at 25°C |
Risiko Koder | R25##Toxic if swallowed.:; |
Sikkerhet Beskrivelse | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |