Chemindex > 613-54-7
NO ▼
613-54-7 alpha-Bromo-2'-acetonaphthone |
|
| produktnavn | alpha-Bromo-2'-acetonaphthone |
| Engelsk navn | alpha-Bromo-2'-acetonaphthone;Bromomethyl 2-naphthyl ketone;alpha-Bromo-2-acetonaphthone;2-(Bromoacetyl)naphthalene;2-(Bromoacetyl)naphthalene;2-bromo-1-(naphthalen-2-yl)ethanone;α-Bromo-2-acetonaphthone;2-Bromo-2'-acetonaphthone;2-Bromo-1-(2-naphthyl)-1-ethanone |
| Molekylær Formel | C12H9BrO |
| Molekylvekt | 249.1033 |
| InChI | InChI=1/C12H9BrO/c13-8-12(14)11-6-5-9-3-1-2-4-10(9)7-11/h1-7H,8H2 |
| CAS-nummer | 613-54-7 |
| EINECS | 210-348-7 |
| Molecular Structure |  |
| Tetthet | 1.48g/cm3 |
| Smeltepunkt | 82-85℃ |
| Kokepunkt | 349.8°C at 760 mmHg |
| Brytningsindeks | 1.656 |
| Flammepunktet | 99.1°C |
| Damptrykk | 4.59E-05mmHg at 25°C |
| Hazard symboler |  C##Corrosive:; |
| Risiko Koder | R34##Causes burns.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 