ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
9,10-Dihydroanthracene |
|
produktnavn | 9,10-Dihydroanthracene |
Engelsk navn | 9,10-Dihydroanthracene;AI3-09026;Anthracene, dihydro-;NSC 30805;Anthracene, 9,10-dihydro- |
Molekylær Formel | C14H12 |
Molekylvekt | 180.2451 |
InChI | InChI=1/C14H12/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-8H,9-10H2 |
CAS-nummer | 613-31-0 |
EINECS | 210-336-1 |
Molecular Structure | |
Tetthet | 1.085g/cm3 |
Smeltepunkt | 104-107℃ |
Kokepunkt | 305°C at 760 mmHg |
Brytningsindeks | 1.62 |
Flammepunktet | 131.8°C |
Damptrykk | 0.00152mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |