ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-methylquinolin-6-ol |
|
produktnavn | 2-methylquinolin-6-ol |
Engelsk navn | 2-methylquinolin-6-ol;6-Hydroxy-2-methylquinoline;2-Methyl-6-hydroxyquinoline;2-Methyl-6-hydroxyquinoine |
Molekylær Formel | C10H9NO |
Molekylvekt | 159.1846 |
InChI | InChI=1/C10H9NO/c1-7-2-3-8-6-9(12)4-5-10(8)11-7/h2-6,12H,1H3 |
CAS-nummer | 613-21-8 |
Molecular Structure | |
Tetthet | 1.21g/cm3 |
Smeltepunkt | 198℃ |
Kokepunkt | 304.5°C at 760 mmHg |
Brytningsindeks | 1.666 |
Flammepunktet | 142.3°C |
Damptrykk | 0.000483mmHg at 25°C |
Hazard symboler | Xi##Irritant:; |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |