ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Aminoanthracene |
|
produktnavn | 2-Aminoanthracene |
Engelsk navn | 2-Aminoanthracene;2-anthramine practical grade*crystalline;2-anthrylamine;2-Anthramine;2-Anthranamine;anthracen-2-amine;2-Anthracenamide; |
Molekylær Formel | C14H11N |
Molekylvekt | 193.2438 |
InChI | InChI=1/C14H11N/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H,15H2 |
CAS-nummer | 613-13-8 |
EINECS | 210-330-9 |
Molecular Structure | |
Tetthet | 1.208g/cm3 |
Smeltepunkt | 238-241℃ |
Kokepunkt | 414.2°C at 760 mmHg |
Brytningsindeks | 1.765 |
Flammepunktet | 229°C |
Damptrykk | 4.52E-07mmHg at 25°C |
Hazard symboler | Xn##Harmful:; |
Risiko Koder | R33##Danger of cummulative effects.:; |
Sikkerhet Beskrivelse | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |