ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
613-12-7 2-Methylanthracene |
|
produktnavn | 2-Methylanthracene |
Engelsk navn | 2-Methylanthracene;CCRIS 2739;NSC 87376;Anthracene, 2-methyl- |
Molekylær Formel | C15H12 |
Molekylvekt | 192.2558 |
InChI | InChI=1/C15H12/c1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(11)13/h2-10H,1H3 |
CAS-nummer | 613-12-7 |
EINECS | 210-329-3 |
Molecular Structure | |
Tetthet | 1.105g/cm3 |
Smeltepunkt | 202-206℃ |
Kokepunkt | 347.2°C at 760 mmHg |
Brytningsindeks | 1.693 |
Flammepunktet | 157.5°C |
Damptrykk | 0.00011mmHg at 25°C |
Hazard symboler | Xn##Harmful:; |
Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |