ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
610-96-8 Methyl 2-chlorobenzoate |
|
produktnavn | Methyl 2-chlorobenzoate |
Engelsk navn | Methyl 2-chlorobenzoate;Chlorobenzoic acid methyl ester;O-Chlorobenzoic Acid Methyl Ester;2-Chlorobenzoic Acid Methyl Ester |
Molekylær Formel | C8H7ClO2 |
Molekylvekt | 170.593 |
InChI | InChI=1/C8H7ClO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3 |
CAS-nummer | 610-96-8 |
EINECS | 210-242-0 |
Molecular Structure | ![]() |
Tetthet | 1.224g/cm3 |
Kokepunkt | 225.4°C at 760 mmHg |
Brytningsindeks | 1.528 |
Flammepunktet | 101.7°C |
Damptrykk | 0.0868mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R36/37/38:; |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |