ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-nitrofenylacetat |
|
produktnavn | 2-nitrofenylacetat |
Synonymer | ; 2-nitrofenylacetat; Eddiksyre 2-nitrofenylester; |
Engelsk navn | 2-nitrophenyl acetate;2-Nitrophenyl acetate;Acetic acid 2-nitrophenyl ester |
Molekylær Formel | C8H7NO4 |
Molekylvekt | 181.1455 |
InChI | InChI=1/C8H7NO4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3 |
CAS-nummer | 610-69-5 |
EINECS | 210-233-1 |
Molecular Structure | |
Tetthet | 1.304g/cm3 |
Smeltepunkt | 39-41℃ |
Kokepunkt | 274.8°C at 760 mmHg |
Brytningsindeks | 1.548 |
Flammepunktet | 139.8°C |
Damptrykk | 0.00528mmHg at 25°C |
Sikkerhet Beskrivelse | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |