ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
610-34-4 Ethyl 2-nitrobenzoate |
|
produktnavn | Ethyl 2-nitrobenzoate |
Engelsk navn | Ethyl 2-nitrobenzoate;2-Nitrobenzoic acid ethyl ester |
Molekylær Formel | C9H9NO4 |
Molekylvekt | 195.1721 |
InChI | InChI=1/C9H9NO4/c1-2-14-9(11)7-5-3-4-6-8(7)10(12)13/h3-6H,2H2,1H3 |
CAS-nummer | 610-34-4 |
EINECS | 210-220-0 |
Molecular Structure | |
Tetthet | 1.253g/cm3 |
Smeltepunkt | 26-174℃ |
Kokepunkt | 275°C at 760 mmHg |
Brytningsindeks | 1.544 |
Flammepunktet | 126.1°C |
Damptrykk | 0.00523mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |