ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Isatin-3-oxime |
|
produktnavn | Isatin-3-oxime |
Engelsk navn | Isatin-3-oxime;3-hydroxyiminoindolin-2-one;beta-Isatoxime;3-(hydroxyamino)-2H-indol-2-one |
Molekylær Formel | C8H6N2O2 |
Molekylvekt | 162.1454 |
InChI | InChI=1/C8H6N2O2/c11-8-7(10-12)5-3-1-2-4-6(5)9-8/h1-4,12H,(H,9,10,11) |
CAS-nummer | 607-28-3 |
EINECS | 210-132-2 |
Molecular Structure | |
Tetthet | 1.49g/cm3 |
Smeltepunkt | 210-214℃ |
Kokepunkt | 400.5°C at 760 mmHg |
Brytningsindeks | 1.706 |
Flammepunktet | 196°C |
Damptrykk | 4.43E-08mmHg at 25°C |
Sikkerhet Beskrivelse | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |