ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
N-Methylcarbostyril |
|
produktnavn | N-Methylcarbostyril |
Engelsk navn | N-Methylcarbostyril;2-Hydroxy-1-methylquinoline;N-Methylcarbostyril;1-methylquinolin-2(1H)-one;1-methyl-2-Quinolinone |
Molekylær Formel | C10H9NO |
Molekylvekt | 159.1846 |
InChI | InChI=1/C10H9NO/c1-11-9-5-3-2-4-8(9)6-7-10(11)12/h2-7H,1H3 |
CAS-nummer | 606-43-9 |
Molecular Structure | |
Tetthet | 1.16g/cm3 |
Kokepunkt | 247.5°C at 760 mmHg |
Brytningsindeks | 1.592 |
Flammepunktet | 106.8°C |
Damptrykk | 0.0255mmHg at 25°C |
Sikkerhet Beskrivelse | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |