ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
605-02-7 1-Phenylnaphthalene |
|
produktnavn | 1-Phenylnaphthalene |
Engelsk navn | 1-Phenylnaphthalene;NSC 5257;Naphthalene, 1-phenyl-;Naphthalene, 1-phenyl- (8CI)(9CI) |
Molekylær Formel | C16H12 |
Molekylvekt | 204.2665 |
InChI | InChI=1/C16H12/c1-2-7-13(8-3-1)16-12-6-10-14-9-4-5-11-15(14)16/h1-12H |
CAS-nummer | 605-02-7 |
EINECS | 210-081-6 |
Molecular Structure | |
Tetthet | 1.081g/cm3 |
Kokepunkt | 336.4°C at 760 mmHg |
Brytningsindeks | 1.647 |
Flammepunktet | 148.2°C |
Damptrykk | 0.000219mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |