ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
602-60-8 9-nitroanthracene |
|
produktnavn | 9-nitroanthracene |
Engelsk navn | 9-nitroanthracene;9-Nitroanthracene (purity);1-nitroanthracene |
Molekylær Formel | C14H9NO2 |
Molekylvekt | 223.2268 |
InChI | InChI=1/C14H9NO2/c16-15(17)14-7-3-6-12-8-10-4-1-2-5-11(10)9-13(12)14/h1-9H |
CAS-nummer | 602-60-8 |
EINECS | 210-021-9 |
Molecular Structure | |
Tetthet | 1.316g/cm3 |
Smeltepunkt | 144-144℃ |
Kokepunkt | 413.3°C at 760 mmHg |
Brytningsindeks | 1.741 |
Flammepunktet | 207.5°C |
Damptrykk | 1.16E-06mmHg at 25°C |
Sikkerhet Beskrivelse | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |