ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59-82-5 5-Nitro-2-furonitrile |
|
produktnavn | 5-Nitro-2-furonitrile |
Engelsk navn | 5-Nitro-2-furonitrile;5-Nitro-2-furancarbonitrile;5-nitrofuran-2-carbonitrile |
Molekylær Formel | C5H2N2O3 |
Molekylvekt | 138.081 |
InChI | InChI=1/C5H2N2O3/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
CAS-nummer | 59-82-5 |
Molecular Structure | ![]() |
Tetthet | 1.46g/cm3 |
Kokepunkt | 234.7°C at 760 mmHg |
Brytningsindeks | 1.544 |
Flammepunktet | 95.7°C |
Damptrykk | 0.0522mmHg at 25°C |
Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Sikkerhet Beskrivelse | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |