ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
58971-11-2 3-Bromophenethylamine |
|
produktnavn | 3-Bromophenethylamine |
Engelsk navn | 3-Bromophenethylamine;2-(3-bromophenyl)ethanaminium;2-(3-bromophenyl)ethanamine;3-Bromo-benzeneethanamine |
Molekylær Formel | C8H10BrN |
Molekylvekt | 200.0757 |
InChI | InChI=1/C8H10BrN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4-5,10H2 |
CAS-nummer | 58971-11-2 |
Molecular Structure | |
Tetthet | 1.407g/cm3 |
Kokepunkt | 263.4°C at 760 mmHg |
Brytningsindeks | 1.575 |
Flammepunktet | 113.1°C |
Damptrykk | 0.0103mmHg at 25°C |
Hazard symboler | C##Corrosive:; |
Risiko Koder | R34##Causes burns.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |