ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5524-05-0 (+)-Dihydrocarvone |
|
produktnavn | (+)-Dihydrocarvone |
Engelsk navn | (+)-Dihydrocarvone;(+)-Dihydrocarvone, mixture of isomers;p-Menth-8(9)-en-2-one;8-p-Menthen-2-one;(2R,5R)-2-methyl-5-(prop-1-en-2-yl)cyclohexanone;(2S,5R)-2-methyl-5-(prop-1-en-2-yl)cyclohexanone |
Molekylær Formel | C10H16O |
Molekylvekt | 152.2334 |
InChI | InChI=1/C10H16O/c1-7(2)9-5-4-8(3)10(11)6-9/h8-9H,1,4-6H2,2-3H3/t8-,9+/m0/s1 |
CAS-nummer | 5524-05-0 |
EINECS | 226-872-4 |
Molecular Structure | |
Tetthet | 0.903g/cm3 |
Kokepunkt | 221.5°C at 760 mmHg |
Brytningsindeks | 1.457 |
Flammepunktet | 82.6°C |
Damptrykk | 0.107mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |