Chemindex > 54792-21-1
NO ▼
54792-21-1 4-(2,4-dichlorophenoxy)butyric acid, compound with 2,2'-iminodiethanol (1:1) |
|
| produktnavn | 4-(2,4-dichlorophenoxy)butyric acid, compound with 2,2'-iminodiethanol (1:1) |
| Engelsk navn | 4-(2,4-dichlorophenoxy)butyric acid, compound with 2,2'-iminodiethanol (1:1);4-(2,4-Dichlorophenoxy)butyric acid, compound with 2,2'-iminodiethanol (1:1);4-(2,4-dichlorophenoxy)butanoic acid - 2,2'-iminodiethanol (1:1) |
| Molekylær Formel | C14H21Cl2NO5 |
| Molekylvekt | 354.2262 |
| InChI | InChI=1/C10H10Cl2O3.C4H11NO2/c11-7-3-4-9(8(12)6-7)15-5-1-2-10(13)14;6-3-1-5-2-4-7/h3-4,6H,1-2,5H2,(H,13,14);5-7H,1-4H2 |
| CAS-nummer | 54792-21-1 |
| EINECS | 259-353-6 |
| Molecular Structure |  |
| Kokepunkt | 410.4°C at 760 mmHg |
| Flammepunktet | 202°C |
| Damptrykk | 1.8E-07mmHg at 25°C |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 54792-21-1 (0):
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 