ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Carboxy-3,4-dimethoxybenzaldehyde |
|
produktnavn | 2-Carboxy-3,4-dimethoxybenzaldehyde |
Engelsk navn | 2-Carboxy-3,4-dimethoxybenzaldehyde;5,6-Dimethoxyphthalaldehydic acid~6-Formyl-2,3-dimethoxybenzoic acid~Opianic acid;6-formyl-2,3-dimethoxybenzoic acid |
Molekylær Formel | C10H10O5 |
Molekylvekt | 210.1834 |
InChI | InChI=1/C10H10O5/c1-14-7-4-3-6(5-11)8(10(12)13)9(7)15-2/h3-5H,1-2H3,(H,12,13) |
CAS-nummer | 519-05-1 |
EINECS | 208-261-4 |
Molecular Structure | |
Tetthet | 1.3g/cm3 |
Kokepunkt | 386.3°C at 760 mmHg |
Brytningsindeks | 1.573 |
Flammepunktet | 155.1°C |
Damptrykk | 1.17E-06mmHg at 25°C |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |