ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
513-86-0 Acetyl methyl carbinol |
|
produktnavn | Acetyl methyl carbinol |
Engelsk navn | Acetyl methyl carbinol;3-Hydroxy-2-butanone;acetoin, mixture of monomer and dimer;Acetoin (3-Hydroxy-2-butanone);1-acetylethanol;Acetoin;3-hydroxybutan-2-one;(3R)-3-hydroxybutan-2-one;(3S)-3-hydroxybutan-2-one;Acetoion;Acetion |
Molekylær Formel | C4H8O2 |
Molekylvekt | 88.1051 |
InChI | InChI=1/C4H8O2/c1-3(5)4(2)6/h3,5H,1-2H3/t3-/m0/s1 |
CAS-nummer | 513-86-0 |
EINECS | 208-174-1 |
Molecular Structure | ![]() |
Tetthet | 0.983g/cm3 |
Smeltepunkt | 15℃ |
Kokepunkt | 145.4°C at 760 mmHg |
Brytningsindeks | 1.408 |
Flammepunktet | 49.7°C |
Vannløselighet | SOLUBLE |
Damptrykk | 1.92mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R10||R36/38:; |
Sikkerhet Beskrivelse | S26||S36/37:; |
MSDS |