ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
butane-2,3-diol |
|
produktnavn | butane-2,3-diol |
Engelsk navn | butane-2,3-diol;2,3-Butanediol;2,3-Dihydroxybutane;2,3-Butanediol, mixture of DL and meso;2,3-butylene glycol;(2R,3S)-butane-2,3-diol |
Molekylær Formel | C4H10O2 |
Molekylvekt | 90.121 |
InChI | InChI=1/C4H10O2/c1-3(5)4(2)6/h3-6H,1-2H3 |
CAS-nummer | 513-85-9;123513-85-9 |
EINECS | 208-173-6 |
Molecular Structure | |
Tetthet | 0.997g/cm3 |
Smeltepunkt | 25℃ |
Kokepunkt | 180.7°C at 760 mmHg |
Brytningsindeks | 1.434 |
Flammepunktet | 85°C |
Vannløselighet | SOLUBLE |
Damptrykk | 0.26mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25:; |
MSDS |