ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
16-Hydroxyhexadecanoic acid |
|
produktnavn | 16-Hydroxyhexadecanoic acid |
Engelsk navn | 16-Hydroxyhexadecanoic acid;Juniperic acid;16-hydroxyhexadecanoate |
Molekylær Formel | C16H31O3 |
Molekylvekt | 271.4161 |
InChI | InChI=1/C16H32O3/c17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(18)19/h17H,1-15H2,(H,18,19)/p-1 |
CAS-nummer | 506-13-8 |
EINECS | 208-028-7 |
Molecular Structure | |
Smeltepunkt | 95-99℃ |
Kokepunkt | 414.4°C at 760 mmHg |
Flammepunktet | 218.6°C |
Damptrykk | 1.34E-08mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |