ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
501-24-6 3-n-Pentadecylphenol |
|
produktnavn | 3-n-Pentadecylphenol |
Engelsk navn | 3-n-Pentadecylphenol;Pentadecylphenol;3-pentadecylphenol;3-Pentadecyl phenol |
Molekylær Formel | C21H36O |
Molekylvekt | 304.5099 |
InChI | InChI=1/C21H36O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-20-17-15-18-21(22)19-20/h15,17-19,22H,2-14,16H2,1H3 |
CAS-nummer | 501-24-6 |
EINECS | 207-921-9 |
Molecular Structure | |
Tetthet | 0.908g/cm3 |
Smeltepunkt | 47-53℃ |
Kokepunkt | 402°C at 760 mmHg |
Brytningsindeks | 1.495 |
Flammepunktet | 246.3°C |
Damptrykk | 4.88E-07mmHg at 25°C |
Hazard symboler | Xi##Irritant:; |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |