ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
6-(Methylthio)purine |
|
produktnavn | 6-(Methylthio)purine |
Engelsk navn | 6-(Methylthio)purine;6-(Methylmercapto)purine;6-(Methylsulfanyl)-9H-purine;6-(methylsulfanyl)-7H-purine;6-(methylsulfanyl)-5H-purine |
Molekylær Formel | C6H6N4S |
Molekylvekt | 166.2036 |
InChI | InChI=1/C6H6N4S/c1-11-6-4-5(8-2-7-4)9-3-10-6/h2-4H,1H3 |
CAS-nummer | 50-66-8 |
EINECS | 200-057-3 |
Molecular Structure | |
Tetthet | 1.59g/cm3 |
Smeltepunkt | 221-222℃ |
Kokepunkt | 290.9°C at 760 mmHg |
Brytningsindeks | 1.806 |
Flammepunktet | 129.7°C |
Damptrykk | 0.00351mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |