ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
499771-17-4 2-[4-(2,3-dihydro-1,4-benzodioksin-6-yl)-1,3-tiazol-2-yl]acetonitril |
|
produktnavn | 2-[4-(2,3-dihydro-1,4-benzodioksin-6-yl)-1,3-tiazol-2-yl]acetonitril |
Synonymer | [4-(2,3-dihydro-1,4-benzodioksin-6-yl)-1,3-tiazol-2-yl]acetonitril; |
Engelsk navn | 2-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]acetonitrile;[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]acetonitrile |
Molekylær Formel | C13H10N2O2S |
Molekylvekt | 258.2957 |
InChI | InChI=1/C13H10N2O2S/c14-4-3-13-15-10(8-18-13)9-1-2-11-12(7-9)17-6-5-16-11/h1-2,7-8H,3,5-6H2 |
CAS-nummer | 499771-17-4 |
Molecular Structure | |
Tetthet | 1.341g/cm3 |
Smeltepunkt | 115℃ |
Kokepunkt | 456.2°C at 760 mmHg |
Brytningsindeks | 1.619 |
Flammepunktet | 229.7°C |
Damptrykk | 1.65E-08mmHg at 25°C |
Hazard symboler | Xn##Harmful:; |
Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Sikkerhet Beskrivelse | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |