ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4707-46-4 2,4-Dihydroxy-3,6-dimethylbenzoic acid |
|
produktnavn | 2,4-Dihydroxy-3,6-dimethylbenzoic acid |
Engelsk navn | 2,4-Dihydroxy-3,6-dimethylbenzoic acid;3,6-Dimethyl-2,4-dihydroxybenzoic acid |
Molekylær Formel | C9H10O4 |
Molekylvekt | 182.1733 |
InChI | InChI=1/C9H10O4/c1-4-3-6(10)5(2)8(11)7(4)9(12)13/h3,10-11H,1-2H3,(H,12,13) |
CAS-nummer | 4707-46-4 |
Molecular Structure | |
Tetthet | 1.386g/cm3 |
Kokepunkt | 407.4°C at 760 mmHg |
Brytningsindeks | 1.627 |
Flammepunktet | 214.3°C |
Damptrykk | 2.29E-07mmHg at 25°C |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |