ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4-Fluoro-N-methylaniline |
|
produktnavn | 4-Fluoro-N-methylaniline |
Engelsk navn | 4-Fluoro-N-methylaniline;4-Fluoro-N-toluidine |
Molekylær Formel | C7H8FN |
Molekylvekt | 125.1435 |
InChI | InChI=1/C7H8FN/c1-9-7-4-2-6(8)3-5-7/h2-5,9H,1H3 |
CAS-nummer | 459-59-6 |
EINECS | 207-294-1 |
Molecular Structure | |
Tetthet | 1.106g/cm3 |
Kokepunkt | 181.4°C at 760 mmHg |
Brytningsindeks | 1.546 |
Flammepunktet | 63.5°C |
Damptrykk | 0.853mmHg at 25°C |
Hazard symboler | Xi##Irritant:; |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |