ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
alpha,alpha-Difluoroanisole |
|
produktnavn | alpha,alpha-Difluoroanisole |
Engelsk navn | alpha,alpha-Difluoroanisole;(Difluoromethoxy)benzene |
Molekylær Formel | C7H6F2O |
Molekylvekt | 144.1187 |
InChI | InChI=1/C7H6F2O/c8-7(9)10-6-4-2-1-3-5-6/h1-5,7H |
CAS-nummer | 458-92-4 |
EINECS | 207-283-1 |
Molecular Structure | |
Tetthet | 1.155g/cm3 |
Kokepunkt | 138°C at 760 mmHg |
Brytningsindeks | 1.445 |
Flammepunktet | 43.1°C |
Damptrykk | 8.52mmHg at 25°C |
Risiko Koder | R10##Flammable.:; |
Sikkerhet Beskrivelse | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |