ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
458-05-9 1-(3-fluorophenyl)-2-thiourea |
|
produktnavn | 1-(3-fluorophenyl)-2-thiourea |
Engelsk navn | 1-(3-fluorophenyl)-2-thiourea;3-Fluorophenylthiourea;1-(3-fluorophenyl)thiourea |
Molekylær Formel | C7H7FN2S |
Molekylvekt | 170.2073 |
InChI | InChI=1/C7H7FN2S/c8-5-2-1-3-6(4-5)10-7(9)11/h1-4H,(H3,9,10,11) |
CAS-nummer | 458-05-9 |
Molecular Structure | ![]() |
Tetthet | 1.397g/cm3 |
Kokepunkt | 259.3°C at 760 mmHg |
Brytningsindeks | 1.692 |
Flammepunktet | 110.6°C |
Damptrykk | 0.0131mmHg at 25°C |
Risiko Koder | R25##Toxic if swallowed.:; |
Sikkerhet Beskrivelse | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |