ChemIndex - En gratis kjemisk CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
3-fluorobenzamide |
|
produktnavn | 3-fluorobenzamide |
Engelsk navn | 3-fluorobenzamide;m-Fluorobenzamide |
Molekylær Formel | C7H6FNO |
Molekylvekt | 139.127 |
InChI | InChI=1/C7H6FNO/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,(H2,9,10) |
CAS-nummer | 455-37-8 |
EINECS | 207-247-5 |
Molecular Structure | |
Tetthet | 1.238g/cm3 |
Smeltepunkt | 129-132℃ |
Kokepunkt | 238.4°C at 760 mmHg |
Brytningsindeks | 1.538 |
Flammepunktet | 98°C |
Damptrykk | 0.0426mmHg at 25°C |
Hazard symboler | Xi##Irritant:; |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |