ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
454-29-5 DL-Homocysteine |
|
produktnavn | DL-Homocysteine |
Engelsk navn | DL-Homocysteine;DL-Homocysteine 2-Amino-4-mercaptobuyric acid;homocysteine;D-homocysteine |
Molekylær Formel | C4H9NO2S |
Molekylvekt | 135.1848 |
InChI | InChI=1/C4H9NO2S/c5-3(1-2-8)4(6)7/h3,8H,1-2,5H2,(H,6,7)/t3-/m1/s1 |
CAS-nummer | 454-29-5 |
EINECS | 207-222-9 |
Molecular Structure | |
Tetthet | 1.259g/cm3 |
Smeltepunkt | 232-233℃ |
Kokepunkt | 299.7°C at 760 mmHg |
Brytningsindeks | 1.537 |
Flammepunktet | 135°C |
Damptrykk | 0.000278mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |