ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
451-13-8 2,5-Dihydroxyphenylacetic acid |
|
produktnavn | 2,5-Dihydroxyphenylacetic acid |
Engelsk navn | 2,5-Dihydroxyphenylacetic acid;homogentisic acid free acid;Homogentisic acid 2,5-Dihydroxyphenylacetic acid;Homogentisicacid;Homogentisic acid;(2,5-dihydroxyphenyl)acetate |
Molekylær Formel | C8H7O4 |
Molekylvekt | 167.1393 |
InChI | InChI=1/C8H8O4/c9-6-1-2-7(10)5(3-6)4-8(11)12/h1-3,9-10H,4H2,(H,11,12)/p-1 |
CAS-nummer | 451-13-8 |
EINECS | 207-192-7 |
Molecular Structure | |
Smeltepunkt | 147-153℃ |
Kokepunkt | 439.3°C at 760 mmHg |
Flammepunktet | 233.6°C |
Damptrykk | 1.71E-08mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
MSDS |